![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| zoo_galaxies.pdf | 2015-09-01 17:48 | 1.4M | |
| zlt1-1.pdf | 2015-09-01 17:48 | 4.8M | |
| zaritsky_scaling_relations.pdf | 2015-09-01 17:48 | 465K | |
| yun_reddy_condon.pdf | 2015-09-01 17:48 | 649K | |
| xray_SF.pdf | 2015-09-01 17:48 | 305K | |
| www.mpia.de_homes_rix_Present_Day_Galaxy_Population_2011.pdf | 2015-09-01 17:48 | 699K | |
| www.mpia.de_homes_rix_Galaxy_Dynamics_2011_2.pdf | 2015-09-01 17:48 | 2.5M | |
| wsu.feb08.pdf | 2015-09-01 17:48 | 11M | |
| week8.pdf | 2015-09-01 17:48 | 7.3M | |
| weak_lensing_Hokstra.pdf | 2015-09-01 17:48 | 1.5M | |
| van der Maerl.pdf | 2015-09-01 17:48 | 193K | |
| van_der_maerl_m31_mw_merger.pdf | 2015-09-01 17:48 | 4.0M | |
| vanDokkum_2013.pdf | 2015-09-01 17:48 | 205K | |
| treu_lensing.pdf | 2015-09-01 17:48 | 823K | |
| thin_disk_potential.pdf | 2015-09-01 17:48 | 74K | |
| test_2004_2.pdf | 2015-09-01 17:48 | 33K | |
| test_2004-2.pdf | 2015-09-01 17:48 | 23K | |
| test_0506.pdf | 2015-09-01 17:48 | 32K | |
| sun_chemical_asplund_ann_rev.pdf | 2015-09-01 17:48 | 921K | |
| structure01.pdf | 2013-09-20 14:22 | 1.3M | |
| stlawrence_cruise.pdf | 2015-09-01 17:48 | 6.6M | |
| stellarpops11_lec4.pdf | 2015-09-01 17:48 | 7.3M | |
| stellarpops11_lec3.pdf | 2015-09-01 17:48 | 3.4M | |
| stellarpops11_lec2.pdf | 2015-09-01 17:48 | 2.8M | |
| stellarpops11_lec1.pdf | 2015-09-01 17:48 | 5.1M | |
| stellar_pops_lec4_5.pdf | 2015-09-01 17:48 | 19M | |
| stellar_pops_lec2.pdf | 2015-09-01 17:48 | 10M | |
| stellar_dynamics.pdf | 2015-09-01 17:48 | 107K | |
| stellar_abundances.pdf | 2015-09-01 17:48 | 802K | |
| stellar-astro_collins.pdf | 2015-09-01 17:48 | 623K | |
| starspectra.pdf | 2015-09-01 17:48 | 58K | |
| stars-pp.pdf | 2015-09-01 17:48 | 2.6M | |
| starling.pdf | 2015-09-01 17:48 | 448K | |
| star formation.pdf | 2015-09-01 17:48 | 6.2M | |
| starform-2.pdf | 2015-09-01 17:48 | 8.4M | |
| star_motions.pdf | 2015-09-01 17:48 | 49K | |
| star_history.pdf | 2015-09-01 17:48 | 1.1M | |
| star_from_Ha_stars.pdf | 2015-09-01 17:48 | 1.8M | |
| star_formation_mol_gas.pdf | 2015-09-01 17:48 | 1.0M | |
| star_form_models.pdf | 2015-09-01 17:48 | 3.1M | |
| star_form_Lada.pdf | 2015-09-01 17:48 | 4.0M | |
| ssp_IR_modeling.pdf | 2015-09-01 17:48 | 3.8M | |
| spirals_psu.pdf | 2015-09-01 17:48 | 5.4M | |
| spirals-pp.pdf | 2015-09-01 17:48 | 1.9M | |
| spiralarm.pdf | 2015-09-01 17:48 | 82K | |
| spiral_scaling.pdf | 2015-09-01 17:48 | 1.9M | |
| spiral_density_wave.pdf | 2015-09-01 17:48 | 1.5M | |
| sofue_review_MW_mass.pdf | 2015-09-01 17:48 | 606K | |
| silk_gal_form.pdf | 2015-09-01 17:48 | 3.6M | |
| sfr_z_.pdf | 2015-09-01 17:48 | 4.1M | |
| sfr_goodman.pdf | 2015-09-01 17:48 | 45M | |
| sf_unit_area.pdf | 2015-09-01 17:48 | 1.1M | |
| sed.pdf | 2015-09-01 17:48 | 6.7M | |
| sed-2009.pdf | 2015-09-01 17:48 | 20M | |
| sdsg2.pdf | 2015-09-01 17:48 | 80K | |
| sdsg1old.pdf | 2015-09-01 17:48 | 30K | |
| schwarschild_technique.pdf | 2015-09-01 17:48 | 2.6M | |
| schtecter_lec1.pdf | 2015-09-01 17:48 | 144K | |
| schecter_lec3.pdf | 2015-09-01 17:48 | 140K | |
| schecter_lec2.pdf | 2015-09-01 17:48 | 210K | |
| rotcurves.pdf | 2015-09-01 17:48 | 47K | |
| rossa_dettmar_sfr.pdf | 2015-09-01 17:48 | 303K | |
| rivolos.pdf | 2015-09-01 17:48 | 1.4M | |
| resolved_stellar_history.pdf | 2015-09-01 17:48 | 8.9M | |
| remant_masses_HW2.pdf | 2015-09-01 17:48 | 1.9M | |
| reid_MW_mass.pdf | 2015-09-01 17:48 | 436K | |
| reid_GC_distance_1993.pdf | 2015-09-01 17:48 | 880K | |
| radio_EXCESS_IR.pdf | 2015-09-01 17:48 | 808K | |
| psu_galaxies_1.pdf | 2015-09-01 17:48 | 324K | |
| ps1_solutions.pdf | 2015-09-01 17:48 | 179K | |
| problem_set5.pdf | 2015-09-01 17:48 | 173K | |
| problem_set2.pdf | 2015-09-01 17:48 | 142K | |
| problem_set1.pdf | 2015-09-01 17:48 | 73K | |
| peterson_agn_properties.pdf | 2015-09-01 17:48 | 3.2M | |
| peterson_BH_masses.pdf | 2015-09-01 17:48 | 2.1M | |
| peebles_DM.pdf | 2015-09-01 17:48 | 93K | |
| orbit_LMC.pdf | 2015-09-01 17:48 | 713K | |
| newman_2012_sfr.pdf | 2015-09-01 17:48 | 498K | |
| nature11096.pdf | 2015-09-01 17:48 | 213K | |
| mw-1.pdf | 2015-09-01 17:48 | 26M | |
| morph_vs_z.pdf | 2015-09-01 17:48 | 1.7M | |
| morph_historgram.tiff | 2015-09-01 17:47 | 20K | |
| morph_desnity_sdss.tiff | 2015-09-01 17:47 | 39K | |
| morph_density_2015.pdf | 2015-09-01 17:48 | 6.1M | |
| morph_complexity.tiff | 2015-09-01 17:47 | 735K | |
| mol_clouds.pdf | 2015-09-01 17:48 | 188K | |
| mid_term.pdf | 2015-09-01 17:48 | 72K | |
| mid-term_421.pdf | 2015-09-01 17:48 | 23K | |
| metallicity_m31.pdf | 2015-09-01 17:48 | 924K | |
| metallicity_Dopita.pdf | 2015-09-01 17:48 | 905K | |
| mechanisms-2.pdf | 2015-09-01 17:48 | 27M | |
| mass function.pdf | 2015-09-01 17:48 | 1.0M | |
| mass_model_mw.pdf | 2015-09-01 17:48 | 364K | |
| mass_func_highz.pdf | 2015-09-01 17:48 | 8.4M | |
| mass_evol_vipers.pdf | 2015-09-01 17:48 | 4.4M | |
| mass_assembly_ultarvista.pdf | 2015-09-01 17:48 | 2.4M | |
| m31.pdf | 2015-09-01 17:48 | 1.7M | |
| loveday_gamma.pdf | 2015-09-01 17:48 | 2.0M | |
| local_universe.pdf | 2015-09-01 17:48 | 6.1M | |
| lensing.pdf | 2015-09-01 17:48 | 17K | |
| kinematics_galaxies_glazebrook.pdf | 2015-09-01 17:48 | 2.7M | |
| kennicutt_evans_review_2012.pdf | 2015-09-01 17:48 | 1.6M | |
| kaastra_thermal_rad.pdf | 2015-09-01 17:48 | 1.2M | |
| jenkins_ism_abundances.pdf | 2015-09-01 17:48 | 376K | |
| intro-2009.pdf | 2015-09-01 17:48 | 63M | |
| intro-1.pdf | 2015-09-01 17:48 | 13M | |
| index_spring2012.html | 2012-05-10 09:46 | 5.6K | |
| index_fall2017.html | 2017-12-13 08:56 | 9.5K | |
| index_fall2015.html | 2015-12-10 16:46 | 7.4K | |
| index_fall2012.html | 2012-12-12 09:41 | 5.6K | |
| imf_lensing.pdf | 2015-09-01 17:48 | 1.8M | |
| imf.pdf | 2015-09-01 17:48 | 201K | |
| ias.short.deepreview.04nov08.pdf | 2015-09-01 17:48 | 12M | |
| hwk2_texas.pdf | 2015-09-01 17:48 | 77K | |
| hw7_lattimer_closed_box.pdf | 2015-09-01 17:48 | 31K | |
| hw6_lattimer.pdf | 2015-09-01 17:48 | 53K | |
| hw5_lattimer.pdf | 2015-09-01 17:48 | 62K | |
| hw2_lattimer.pdf | 2015-09-01 17:48 | 78K | |
| hw2_H_Mo.pdf | 2015-09-01 17:48 | 39K | |
| hst_antennae_9734a.pdf | 2015-09-01 17:48 | 614K | |
| how_gal_grow_sim.pdf | 2015-09-01 17:48 | 6.5M | |
| hiz-1.pdf | 2015-09-01 17:48 | 2.1M | |
| hihgz_massive_gals.pdf | 2015-09-01 17:48 | 2.0M | |
| highz_diag.pdf | 2015-09-01 17:48 | 11M | |
| highz_SF.pdf | 2015-09-01 17:48 | 6.4M | |
| high_z_galaxies.pdf | 2015-09-01 17:48 | 6.3M | |
| h2s_lattimer.pdf | 2015-09-01 17:48 | 45K | |
| gruber_prize_2011.pdf | 2013-09-20 14:22 | 45M | |
| growth_highz_massive.pdf | 2015-09-01 17:48 | 2.3M | |
| grav_lens_treu_ellis.pdf | 2015-09-01 17:48 | 8.6M | |
| graham_ellipticals.pdf | 2015-09-01 17:48 | 833K | |
| glob_clust_energy_equip.pdf | 2015-09-01 17:48 | 362K | |
| gas_mass.pdf | 2015-09-01 17:48 | 129K | |
| gas_in_galaxies_Maiolino.pdf | 2015-09-01 17:48 | 5.8M | |
| gas-pp.pdf | 2015-09-01 17:48 | 3.2M | |
| galstruc-2009.pdf | 2015-09-01 17:48 | 32M | |
| galstruc-1.pdf | 2015-09-01 17:48 | 33M | |
| galdyn2.pdf | 2015-09-01 17:48 | 1.1M | |
| galdyn1.pdf | 2015-09-01 17:48 | 1.5M | |
| galaxy_shapes.pdf | 2015-09-01 17:48 | 779K | |
| galaxy_masses_review.pdf | 2013-09-16 10:26 | 5.3M | |
| galaxy_mass_low_z.pdf | 2015-09-01 17:48 | 4.4M | |
| galaxy_growth_van_dokkum.pdf | 2015-09-01 17:48 | 1.8M | |
| galaxy_evol_Subaru.pdf | 2015-09-01 17:48 | 1.8M | |
| galaxy_dm_evol.pdf | 2015-09-01 17:48 | 917K | |
| galaxy_colors.pdf | 2015-09-01 17:48 | 3.2M | |
| galaxies_psu.pdf | 2015-09-01 17:48 | 324K | |
| galactic_kinematics_binney_rave.pdf | 2015-09-01 17:48 | 1.4M | |
| gal2011_durham_talk_Mullaney.pdf | 2015-09-01 17:48 | 7.8M | |
| fund_plane_z_2.pdf | 2015-09-01 17:48 | 1.1M | |
| fossils of the infant universe.pdf | 2015-10-29 09:57 | 690K | |
| fig10-6_MBW.pdf | 2015-09-01 17:48 | 43K | |
| feedback_erb_nature.pdf | 2015-09-01 17:48 | 2.2M | |
| faber_2007_galaxy_evol.pdf | 2015-09-01 17:48 | 875K | |
| exp_disk_origin.pdf | 2015-09-01 17:48 | 2.1M | |
| exam2008.pdf | 2015-09-01 17:48 | 366K | |
| exam2007.pdf | 2015-09-01 17:48 | 168K | |
| ellis_galaxies.pdf | 2015-09-01 17:48 | 4.6M | |
| ellipticals_psu.pdf | 2015-09-01 17:48 | 1.4M | |
| ellipticals-pp.pdf | 2015-09-01 17:48 | 8.6M | |
| egals_grav_lensing.pdf | 2015-09-01 17:48 | 2.4M | |
| egal_abundances_large_r.pdf | 2015-09-01 17:48 | 667K | |
| efficienvy_SF_Conroy.pdf | 2015-09-01 17:48 | 2.3M | |
| effect_bars.pdf | 2015-09-01 17:48 | 3.7M | |
| dynfriction.pdf | 2015-09-01 17:48 | 13K | |
| dyn.pdf | 2015-09-01 17:48 | 3.4M | |
| dwarfs_fermi_DM.pdf | 2015-09-01 17:48 | 1.5M | |
| dwarfs_age.pdf | 2015-09-01 17:48 | 191K | |
| dwarf_gala_problem.pdf | 2015-09-01 17:48 | 394K | |
| dust_local-group.pdf | 2015-09-01 17:48 | 593K | |
| dust_law_conroy.pdf | 2015-09-01 17:48 | 882K | |
| dust_fits.pdf | 2015-09-01 17:48 | 15M | |
| dust-pp.pdf | 2015-09-01 17:48 | 1.6M | |
| dm_minirev.pdf | 2015-09-01 17:48 | 1.3M | |
| disk_spirals.pdf | 2015-09-01 17:48 | 919K | |
| diag2.pdf | 2015-09-01 17:48 | 10M | |
| diag-2009.pdf | 2015-09-01 17:48 | 19M | |
| ddavis_week9.pdf | 2015-09-01 17:48 | 2.6M | |
| davis_week7.pdf | 2015-09-01 17:48 | 2.0M | |
| davis_week6.pdf | 2015-09-01 17:48 | 2.2M | |
| davis_week5.pdf | 2015-09-01 17:48 | 777K | |
| davis_week04.pdf | 2015-09-01 17:48 | 2.0M | |
| davis_week03.pdf | 2015-09-01 17:48 | 377K | |
| davis_week02.pdf | 2015-09-01 17:48 | 1.2M | |
| davis_week01.pdf | 2015-09-01 17:48 | 4.3M | |
| cuspslope3.pdf | 2015-09-01 17:48 | 90K | |
| cosmic-rays_ARAA.pdf | 2015-09-01 17:48 | 2.0M | |
| coory_sheth_DM_review.pdf | 2015-09-01 17:48 | 2.0M | |
| cool_sf_fdbk-2009.pdf | 2015-09-01 17:48 | 22M | |
| contentsCUP.pdf | 2015-09-01 17:48 | 167K | |
| conselice_highz_morph.pdf | 2015-09-01 17:48 | 1.4M | |
| composite_spectra.pdf | 2015-09-01 17:48 | 2.7M | |
| colors_vs_age_MBW.pdf | 2015-09-01 17:48 | 25K | |
| colors_ellipticals.pdf | 2015-09-01 17:48 | 4.9M | |
| cluster_lenses_ARAA.pdf | 2015-09-01 17:48 | 13M | |
| chem_evol_box_models.pdf | 2015-09-01 17:48 | 617K | |
| chabrier03_imf.pdf | 2015-09-01 17:48 | 943K | |
| calzetti_extinction.pdf | 2015-09-01 17:48 | 912K | |
| calzeti_IR_sfr.pdf | 2015-09-01 17:48 | 1.1M | |
| calibration of sfr.pdf | 2015-09-01 17:48 | 242K | |
| bulges_spheroids.pdf | 2015-09-01 17:48 | 1.5M | |
| bulge_halo.pdf | 2015-09-01 17:48 | 470K | |
| broderick_xray_polarization.pdf | 2015-09-01 17:48 | 24M | |
| boltzman_eq.pdf | 2015-09-01 17:48 | 114K | |
| bimodal.pdf | 2015-09-01 17:48 | 127K | |
| bershady_spiral_disks.pdf | 2015-09-01 17:48 | 155K | |
| bershady-maximal_disk.pdf | 2015-09-01 17:48 | 10M | |
| bell_ir_radio.pdf | 2015-09-01 17:48 | 586K | |
| bell_de_Jong_2001.pdf | 2015-09-01 17:48 | 685K | |
| baryonic_mass_function.pdf | 2015-09-01 17:48 | 2.2M | |
| barnes_egals.pdf | 2015-09-01 17:48 | 350K | |
| atombinding.pdf | 2015-09-01 17:48 | 32K | |
| astro620_chemical_models.pdf | 2015-09-01 17:48 | 5.4M | |
| astro497_7.pdf | 2015-09-01 17:48 | 5.3M | |
| articles/ | 2013-09-20 14:23 | - | |
| araa_kennicutt.pdf | 2013-09-20 14:22 | 360K | |
| annurev_blanton_moustakas.pdf | 2015-09-01 17:48 | 4.6M | |
| annurev-astro-treu.pdf | 2015-09-01 17:48 | 1.6M | |
| annurev-astro-082708-101650.pdf | 2015-09-01 17:48 | 2.1M | |
| annurev-Conroy_203.pdf | 2015-09-01 17:48 | 2.1M | |
| ann_rev_2002_Freeman_Bland.pdf | 2015-09-01 17:48 | 1.2M | |
| alfalfa_gas.pdf | 2015-09-01 17:48 | 7.1M | |
| age_metalis_highz_galaxies.pdf | 2015-09-01 17:48 | 747K | |
| a620_hw3.pdf | 2013-10-29 20:48 | 69K | |
| a620_Elliptical Galaxies_Lec1_2.pdf | 2013-11-26 17:35 | 32M | |
| a421_GAS.lec6.pdf | 2015-09-01 17:48 | 5.2M | |
| a421_GAS._lec7.pdf | 2015-09-01 17:48 | 15M | |
| Wilson_dust_gas.pdf | 2015-09-01 17:48 | 571K | |
| Wilkins_UV_SFR.pdf | 2015-09-01 17:48 | 266K | |
| Vipers_survey.pdf | 2015-09-01 17:48 | 5.6M | |
| UBVRI.pdf | 2015-09-01 17:48 | 44K | |
| Trimble_Shapley_Curtis.pdf | 2013-09-20 14:22 | 2.2M | |
| Trager_StellarPopulations.pdf | 2015-09-01 17:48 | 30M | |
| Tolstoy_Local_group.pdf | 2015-09-01 17:48 | 1.5M | |
| Tidal_GC_2015.pdf | 2015-09-01 17:48 | 3.4M | |
| TF_galaxy_photo.pdf | 2015-09-01 17:48 | 2.0M | |
| Syllabus_Astro 620.pdf | 2015-09-02 14:28 | 57K | |
| Summary.pdf | 2015-09-01 17:48 | 42M | |
| Starformation3-pp.pdf | 2015-09-01 17:48 | 27M | |
| Springel-1_2.pdf | 2015-09-03 10:31 | 11M | |
| Spirals_Lectures_1_2.pdf | 2015-09-01 17:48 | 25M | |
| Spirals.pdf | 2015-09-01 17:48 | 36M | |
| Spiral_structure_review.pdf | 2015-09-01 17:48 | 5.1M | |
| Spiral_formation_Donghia.pdf | 2015-09-01 17:48 | 1.8M | |
| Spiral_Arms-Lec18x.pdf | 2015-09-01 17:48 | 1.4M | |
| Somerville_Dave-review.pdf | 2015-09-01 17:48 | 11M | |
| Smecker-Hane.pdf | 2015-09-01 17:48 | 23M | |
| Skibbaetal09.pdf | 2015-09-01 17:48 | 530K | |
| Silva_dust.pdf | 2015-09-01 17:48 | 472K | |
| Shull_Danforth_baryons.pdf | 2015-09-01 17:48 | 117K | |
| Shi_IR_xray.pdf | 2015-09-01 17:48 | 1.3M | |
| Sf-Hubble_evol.pdf | 2015-09-01 17:48 | 2.3M | |
| Seyfert 2012_043.pdf | 2015-09-01 17:48 | 140K | |
| Scoville_StarFormation.pdf | 2015-09-01 17:48 | 9.0M | |
| Science-2011-Heckman-182-5.pdf | 2015-09-01 17:48 | 496K | |
| Science-2011-Dunlop-Star_Formation History.pdf | 2015-09-01 17:48 | 423K | |
| Science-2009-Gordin-149.pdf | 2013-09-20 14:22 | 187K | |
| Schneider_ch.pdf | 2015-09-01 17:48 | 7.6M | |
| Schenider_MW_ch.pdf | 2015-09-01 17:48 | 5.2M | |
| Scalo_IMF.pdf | 2015-09-01 17:48 | 282K | |
| Sales_galaxy_form.pdf | 2015-09-01 17:48 | 1.1M | |
| Saglia4.pdf | 2015-09-01 17:48 | 42K | |
| SSP.pdf | 2015-09-01 17:48 | 145K | |
| SFR_metals.pdf | 2015-09-01 17:48 | 726K | |
| RotationCurve_MW_M31.pdf | 2015-09-01 17:48 | 418K | |
| Roediger_GC_Abundances.pdf | 2015-09-01 17:48 | 931K | |
| Queen_Mary_chap7.pdf | 2015-09-01 17:48 | 248K | |
| QM_chap5.pdf | 2015-09-01 17:48 | 297K | |
| QM_chap4.pdf | 2015-09-01 17:48 | 133K | |
| QM_chap3.pdf | 2015-09-01 17:48 | 612K | |
| QM_chap2.pdf | 2015-09-01 17:48 | 682K | |
| QM_chap1.pdf | 2015-09-01 17:48 | 443K | |
| Primack_structure_formation.pdf | 2015-09-01 17:48 | 2.8M | |
| Prantzos_chem_evol.pdf | 2015-09-01 17:48 | 1.2M | |
| Pettini_metals.pdf | 2015-09-01 17:48 | 1.8M | |
| Peterson.pdf | 2015-09-01 17:48 | 1.7M | |
| Perryman_GAIA.pdf | 2015-09-01 17:48 | 483K | |
| PT.65_49_stellar_ages.pdf | 2015-09-01 17:48 | 828K | |
| Oort_parameters.pdf | 2017-10-23 17:29 | 654K | |
| Netzer_AGN.pdf | 2012-11-24 17:21 | 822K | |
| NedWright_notes.pdf | 2015-09-01 17:48 | 2.3M | |
| Naryan_Bartlemann_Lensing.pdf | 2012-09-04 10:17 | 748K | |
| NGC5128_abundances.pdf | 2015-09-01 17:48 | 528K | |
| NGC628_IFU_study.pdf | 2015-09-01 17:48 | 3.0M | |
| Mould_abundance.pdf | 2015-09-01 17:48 | 594K | |
| Molecular_ISM_Lecture1.pdf | 2015-09-01 17:48 | 12M | |
| MilkyWay_lec10.pdf | 2015-09-01 17:48 | 7.1M | |
| MilkyWay_lec9.pdf | 2015-09-01 17:48 | 18M | |
| MilkyWay_lec1.pdf | 2015-09-01 17:48 | 26M | |
| MilkyWay.pdf | 2015-09-01 17:48 | 57M | |
| Middleton_2014.pdf | 2015-09-01 17:48 | 272K | |
| Mei_CMD_ellipticals.pdf | 2015-09-01 17:48 | 1.0M | |
| McCarthy_Mitchell.pdf | 2015-09-01 17:48 | 2.7M | |
| Mathews_ARAA-Egals.pdf | 2015-09-01 17:48 | 606K | |
| Martin_Galaxy_Blockcourse.pdf | 2015-09-01 17:48 | 12M | |
| Martin.pdf | 2015-09-01 17:48 | 11M | |
| Madau_Dickinson.pdf | 2015-09-01 17:48 | 1.5M | |
| MW_xray_XMM.pdf | 2015-09-01 17:48 | 15M | |
| MW_revised.pdf | 2015-09-01 17:48 | 209K | |
| MW_massive_stars_Urquhart.pdf | 2015-09-01 17:48 | 1.4M | |
| MW_mass_rave_piffl.pdf | 2015-09-01 17:48 | 855K | |
| MW_mass.pdf | 2015-09-01 17:48 | 1.0M | |
| MW_halo_build.tiff | 2015-06-30 11:07 | 547K | |
| MW_halo.pdf | 2015-09-01 17:48 | 4.1M | |
| MW_galaxy_assembly_vanDokkum.pdf | 2015-09-01 17:48 | 194K | |
| MW_formation_Chiappini.pdf | 2015-09-01 17:48 | 5.1M | |
| MW_as_a_galaxy.pdf | 2015-09-01 17:48 | 1.3M | |
| MW_Rot_curve.pdf | 2015-09-01 17:48 | 1.1M | |
| MW_Hammer_quiet.pdf | 2015-09-01 17:48 | 421K | |
| MW_Halo_review.pdf | 2015-09-01 17:48 | 2.1M | |
| MW_Disk_review_Rix_Bovy.pdf | 2015-09-01 17:48 | 2.5M | |
| MWB_chap1.pdf | 2015-09-01 17:48 | 236K | |
| MUSHOTZKY NSF Budget.pdf | 2015-09-01 17:48 | 71K | |
| MIT_density_Potential_pairs.pdf | 2017-10-24 14:05 | 127K | |
| MBW_galaxy_color_bimodal.pdf | 2015-09-01 17:48 | 127K | |
| MBW_Book_Galaxy.pdf | 2015-09-01 17:48 | 12M | |
| MBH_cores.pdf | 2015-09-01 17:48 | 1.5M | |
| M31_metal_grad.pdf | 2015-09-01 17:48 | 1.7M | |
| M31_PanSTARRS.pdf | 2015-09-01 17:48 | 42M | |
| LumFunction-pp.pdf | 2015-09-01 17:48 | 1.3M | |
| Local group_lec14.pdf | 2015-09-01 17:48 | 8.2M | |
| Local group_lec13.pdf | 2015-09-01 17:48 | 1.9M | |
| Local group.pdf | 2015-09-01 17:48 | 15M | |
| Local_group.pdf | 2012-10-09 17:05 | 15M | |
| Leroy_SFE.pdf | 2015-09-01 17:48 | 9.4M | |
| Leroy_SF.pdf | 2015-09-01 17:48 | 3.4M | |
| Lecture_24.pdf | 2015-09-01 17:48 | 134K | |
| Lecture_10_11.pdf | 2012-10-02 16:58 | 57M | |
| Lecture_9.pdf | 2012-09-27 10:58 | 6.0M | |
| Lecture_7-8.pdf | 2012-09-27 10:57 | 11M | |
| Lecture_4-6.pdf | 2012-09-14 11:09 | 19M | |
| Lecture_3-4.pdf | 2012-09-10 15:58 | 23M | |
| Lecture_1-2.pdf | 2012-09-04 13:48 | 65M | |
| Lecture15-sm.pdf | 2015-09-01 17:48 | 4.2M | |
| Lecture1_2.pdf | 2015-09-01 17:48 | 65M | |
| Law_streams.pdf | 2015-09-01 17:48 | 2.0M | |
| Lattimer_orbits.pdf | 2015-09-01 17:48 | 1.5M | |
| Lattimer_HW2s.pdf | 2015-09-01 17:48 | 45K | |
| LBGtech_HST.pdf | 2015-09-01 17:48 | 83K | |
| LATTIMER_ISM_Lectures.pdf | 2015-09-01 17:48 | 5.0M | |
| Kuijken.pdf | 2015-09-01 17:48 | 7.2M | |
| Kroupa_IMF.pdf | 2015-09-01 17:48 | 403K | |
| Kormendy_classify.pdf | 2015-09-01 17:48 | 2.5M | |
| Kormendy_Galaxy_Evol.pdf | 2015-09-01 17:48 | 6.5M | |
| Kormendy_2009_apjs_182_1_216.pdf | 2015-09-01 17:48 | 10M | |
| Koleva_egal_abundances.pdf | 2015-09-01 17:48 | 5.8M | |
| Kochanek_strong_lensing.pdf | 2012-09-04 10:16 | 125M | |
| Kingfish.pdf | 2015-09-01 17:48 | 1.9M | |
| King_models.pdf | 2015-09-01 17:48 | 317K | |
| Kennicutt_1998.pdf | 2015-09-01 17:48 | 561K | |
| Jeans_eq.pdf | 2017-10-24 14:07 | 133K | |
| Ionized_gas_pogge.pdf | 2015-09-01 17:48 | 429K | |
| IMF_vary.pdf | 2015-09-01 17:48 | 2.9M | |
| IMF_halo.pdf | 2015-09-01 17:48 | 662K | |
| Hubblesq_pro.pdf | 2015-09-01 17:48 | 79K | |
| Hopkins.pdf | 2015-09-01 17:48 | 6.7M | |
| Homework_6_2014.pdf | 2015-09-01 17:48 | 86K | |
| Homework_1_Astro480_2013.pdf | 2015-09-01 17:48 | 66K | |
| Homework5_RM_2014.pdf | 2015-09-01 17:48 | 88K | |
| Homework 5.pdf | 2015-09-01 17:48 | 21K | |
| Homework 4.pdf | 2015-09-01 17:48 | 36K | |
| Homework 4-ASTR 340-2014.pdf | 2015-09-01 17:48 | 65K | |
| Holczer_MSSL.pdf | 2015-09-01 17:48 | 1.5M | |
| Heckman_etal_winds_0002526v1.pdf | 2015-09-01 17:48 | 874K | |
| Heckman_Besy_ARAA.pdf | 2015-09-01 17:48 | 2.1M | |
| H_Atlas_Gamma.pdf | 2015-09-01 17:48 | 4.4M | |
| HW_1_Blaes.pdf | 2015-09-01 17:48 | 1.8M | |
| HI_vanGorkham.pdf | 2015-09-01 17:48 | 2.6M | |
| HI_profile_mass.pdf | 2015-09-01 17:48 | 889K | |
| HI_galaxy_statistics.pdf | 2015-09-01 17:48 | 14M | |
| HI_galaxies.pdf | 2015-09-01 17:48 | 2.6M | |
| HI_dist_MW_Kerp.pdf | 2015-09-01 17:48 | 1.2M | |
| HI_MW.pdf | 2015-09-01 17:48 | 2.8M | |
| HII_region_high_z.pdf | 2015-09-01 17:48 | 1.2M | |
| HIFI_mol_clouds.pdf | 2015-09-01 17:48 | 3.2M | |
| HEAD_2015_Laura_Brenneman.pdf | 2015-09-01 17:48 | 12M | |
| HEAD_2015_David_Weinberg.pdf | 2015-09-01 17:48 | 11M | |
| H-R_Hipparchos.pdf | 2015-09-01 17:48 | 888K | |
| Green_SMBH.pdf | 2015-09-01 17:48 | 1.8M | |
| Graves_M-L.pdf | 2015-09-01 17:48 | 1.0M | |
| Grav_pot_near_sun_Rix.pdf | 2015-09-01 17:48 | 12M | |
| Gilmore_dynamics.pdf | 2015-09-01 17:48 | 244K | |
| Galaxy spectra.pdf | 2015-09-01 17:48 | 1.3M | |
| Galaxy_morph_Buta_review.pdf | 2015-09-01 17:48 | 6.1M | |
| Galaxy_formation_Conselice.pdf | 2015-09-01 17:48 | 397K | |
| Galaxy_Form_Silk.pdf | 2013-12-03 22:19 | 6.8M | |
| Galaxy_Evol_Shlosman.pdf | 2015-09-01 17:48 | 1.3M | |
| Galaxy_Dynamics_2011_2.pdf | 2015-09-01 17:48 | 2.4M | |
| GalaxyEvolution_2011.pdf | 2015-09-01 17:48 | 4.0M | |
| Galaxies_2011_Stellar_Populations2.pdf | 2015-09-01 17:48 | 2.1M | |
| Galaxies.pdf | 2015-09-01 17:48 | 10M | |
| Galax form-change-no_movie.pdf | 2015-09-01 17:48 | 67M | |
| Galactic Rotation.pdf | 2015-09-01 17:48 | 2.6M | |
| GalacticDynamics2-Trager.pdf | 2015-09-01 17:48 | 10M | |
| Gal_Chem_Evol_Gibson.pdf | 2015-09-01 17:48 | 2.5M | |
| GalFormEvol_Ellis.pdf | 2015-09-01 17:48 | 674K | |
| GAS_lec2.pdf | 2015-09-01 17:48 | 14M | |
| GAS_lec1.pdf | 2015-09-01 17:48 | 9.8M | |
| GAS_2017_lec2.pdf | 2017-09-28 14:01 | 11M | |
| GAS.pdf | 2015-09-01 17:47 | 11M | |
| Fundamental_Plane_Djorgovski.pdf | 2015-09-21 21:33 | 17M | |
| Fund_plane_SF_Lara-Lopez.pdf | 2015-09-01 17:47 | 832K | |
| Friedman_solution.pdf | 2013-09-20 14:22 | 371K | |
| Folien3.pdf | 2015-09-01 17:47 | 2.6M | |
| Flores-Cacho_t.pdf | 2015-09-01 17:47 | 8.9M | |
| Ferrara_Dec2_15h40_Elbaz_Extragalactic_Herschel_Planck.pdf | 2015-09-01 17:47 | 4.7M | |
| Feedback_Vogel.pdf | 2015-09-01 17:47 | 6.3M | |
| FePattern2.pdf | 2015-09-01 17:47 | 25K | |
| FW_Lecture_Intro-1.pdf | 2015-09-01 17:47 | 11M | |
| FW_Lecture_ISM.pdf | 2015-09-01 17:47 | 7.2M | |
| FW_Lecture_Gal_Evol.pdf | 2015-09-01 17:47 | 11M | |
| Elliptical Galaxies.pdf | 2015-09-01 17:47 | 28M | |
| Egal_dynamics_review.pdf | 2015-09-01 17:47 | 2.5M | |
| Eage93-pp.pdf | 2015-09-01 17:47 | 209K | |
| Dynamics_Lec3.pdf | 2015-09-01 17:47 | 667K | |
| Dynamics_Lec2.pdf | 2015-09-01 17:47 | 1.1M | |
| Dynamics.pdf | 2015-09-01 17:47 | 3.1M | |
| Dust.pdf | 2015-09-01 17:47 | 6.0M | |
| Draine.pdf | 2015-09-01 17:47 | 14M | |
| Dm_baryons_spiral.pdf | 2015-09-01 17:47 | 1.4M | |
| Diamond-Stanic.pdf | 2015-09-01 17:47 | 2.3M | |
| Davis_week8.pdf | 2015-09-01 17:47 | 7.3M | |
| Davis_11.pdf | 2015-09-01 17:47 | 1.2M | |
| Davis_10.pdf | 2015-09-01 17:47 | 3.4M | |
| Davis_9.pdf | 2015-09-01 17:47 | 2.6M | |
| Dave_PS2soln.pdf | 2015-09-01 17:47 | 76K | |
| Dave_PS2.pdf | 2015-09-01 17:47 | 47K | |
| Dave_PS1soln.pdf | 2015-09-01 17:47 | 89K | |
| Dave_PS1.pdf | 2015-09-01 17:47 | 28K | |
| Dark_matter.pdf | 2015-09-01 17:47 | 1.8M | |
| Daddi_SF_Law.pdf | 2015-09-01 17:47 | 388K | |
| DM_sims.pdf | 2015-09-01 17:47 | 18M | |
| DM_lenses_)guri.pdf | 2015-09-01 17:47 | 618K | |
| DM_jeans_sims.pdf | 2015-09-01 17:47 | 176K | |
| DM_halo_accretion.pdf | 2015-09-01 17:47 | 1.7M | |
| DM_dwarfs_walker.pdf | 2015-09-01 17:47 | 2.1M | |
| DM_Roos.pdf | 2015-09-01 17:47 | 2.1M | |
| DM_IMF_lensing-Newman.pdf | 2015-09-01 17:47 | 653K | |
| DM_History.pdf | 2015-09-01 17:47 | 2.1M | |
| DLA_redshift.pdf | 2015-09-01 17:47 | 142K | |
| Creation of Universe_Science.pdf | 2013-09-20 14:22 | 100K | |
| Cox_ISM_ARAA.pdf | 2015-09-01 17:47 | 909K | |
| Cosmo_sims.pdf | 2015-09-01 17:47 | 11M | |
| Cosmic_Rays_Tibaldo.pdf | 2015-09-01 17:47 | 1.8M | |
| Coppa_SF.pdf | 2015-09-01 17:47 | 7.5M | |
| Cooling_Function_Weinberg.pdf | 2015-09-01 17:47 | 65K | |
| Conselice_galaxy_structure.pdf | 2015-09-01 17:47 | 3.0M | |
| Conroy_SSP.pdf | 2015-09-01 17:47 | 2.0M | |
| Conroy_2013.pdf | 2015-09-01 17:47 | 1.2M | |
| Collsionless_Boltz_Jeans.pptx | 2017-10-24 14:05 | 307K | |
| Chp24a.pdf | 2015-09-01 17:47 | 58M | |
| Chemical_Evol_Trager.pdf | 2015-09-01 17:47 | 4.9M | |
| Cappellari_XX.pdf | 2015-09-01 17:47 | 3.2M | |
| Cappellari_ATLAS_models.pdf | 2015-09-01 17:47 | 3.2M | |
| Cappelari_Fund_Plane.pdf | 2015-09-01 17:47 | 2.2M | |
| Capellari_viral.pdf | 2015-09-01 17:47 | 1.0M | |
| Candels_galaxy_evolution.pdf | 2015-09-01 17:47 | 2.5M | |
| Calzetti_SFR.pdf | 2015-09-01 17:47 | 2.1M | |
| Califa_summary.pdf | 2015-09-01 17:47 | 240K | |
| Califa_results.pdf | 2015-09-01 17:47 | 3.3M | |
| Calif-SF_history.pdf | 2015-09-01 17:47 | 2.4M | |
| CII_Distro_MW.pdf | 2015-09-01 17:47 | 2.6M | |
| CAM2012.pdf | 2015-09-01 17:47 | 25M | |
| C:\nppdf32Log\debuglog.txt | 2017-08-28 11:44 | 120 | |
| Brusa.pdf | 2015-09-01 17:47 | 5.6M | |
| Bovy_disk_DM.pdf | 2015-09-01 17:47 | 277K | |
| Boss_galaxy_mass.pdf | 2015-09-01 17:47 | 2.5M | |
| Bolton_lens_masses.pdf | 2015-09-01 17:47 | 395K | |
| Basic_Gal_Properties_620_2015.pdf | 2015-09-12 09:20 | 9.9M | |
| Basic Galaxy Properties.pdf | 2015-09-01 17:47 | 23M | |
| Barnex_GalaxyDynamicsI.pdf | 2015-09-01 17:47 | 7.5M | |
| Baldry_bimodal_galaxies.pdf | 2015-09-01 17:47 | 646K | |
| Baldry_SDSS_bimodal.pdf | 2015-09-01 17:47 | 646K | |
| BOOK_Saas_Fee_13.pdf | 2015-10-28 09:48 | 21M | |
| BH_massses.pdf | 2015-09-01 17:47 | 481K | |
| Ay20-Lec15x.pdf | 2015-09-01 17:47 | 1.5M | |
| Astro620_MilkyWay.pdf | 2013-10-10 18:49 | 62M | |
| Astro620_Lecture3_2015.pdf | 2015-09-08 21:18 | 11M | |
| Astro620_Hw1.pdf | 2015-09-12 09:20 | 30K | |
| Astro620_Homework_1_2015.pdf | 2015-09-12 09:32 | 36K | |
| Astro620_Basic Galaxy Properties_lec4.pdf | 2013-09-13 09:54 | 23M | |
| Astro421_stellar_pops_lec5.pdf | 2015-09-01 17:47 | 3.5M | |
| Astro421_Syllabus_RM_2012.pdf | 2015-09-01 17:47 | 934K | |
| Astro421_Homework_1.pdf | 2012-09-12 21:54 | 19K | |
| Astro 421 Homework _1.pdf | 2015-09-01 17:47 | 19K | |
| Astro 421 Final _2014_II.pdf | 2015-09-01 17:47 | 180K | |
| Apache_Point_galactic_archeology.pdf | 2015-09-21 09:17 | 8.1M | |
| Aird_AGN_Evol_2015.pdf | 2015-09-01 17:47 | 2.2M | |
| ATLAST_proper_motions.pdf | 2015-09-01 17:47 | 19M | |
| ASTR421ISMPhasesSpirals.pdf | 2015-09-01 17:47 | 781K | |
| ASTR421HW5Solutions.pdf | 2015-09-01 17:47 | 550K | |
| ASTR421HW5Comments.pdf | 2015-09-01 17:47 | 44K | |
| ASTR421HW4Solutions.pdf | 2015-09-01 17:47 | 749K | |
| ASTR421HW4Q4.5Hint.pdf | 2015-09-01 17:47 | 252K | |
| ASTR421HW3chart.pdf | 2015-09-01 17:47 | 13K | |
| ASTR421HW3b.pdf | 2015-09-01 17:47 | 315K | |
| ASTR421HW3Solutions.pdf | 2015-09-01 17:47 | 1.1M | |
| ASTR421HW3.pdf | 2012-10-04 14:40 | 8.4K | |
| ASTR421HW2chart.pdf | 2015-09-01 17:47 | 10K | |
| ASTR421HW2Solutions.pdf | 2015-09-01 17:47 | 1.1M | |
| ASTR421HW2.pdf | 2015-09-01 17:47 | 724K | |
| ASTR421HW1chart.pdf | 2015-09-01 17:47 | 56K | |
| ASTR421HW1Solutions.pdf | 2015-09-01 17:47 | 789K | |
| ASTR421GasEllipticalsvsSpirals.pdf | 2015-09-01 17:47 | 249K | |
| ASTR421ClassQuizSolutions.pdf | 2015-09-01 17:47 | 559K | |
| ARAA_stellar_pops.pdf | 2015-09-01 17:47 | 1.3M | |
| AGN_1_3.pdf | 2015-09-01 17:47 | 19M | |
| AGN_1_2.pdf | 2015-09-01 17:47 | 19M | |
| AGN_1_1.pdf | 2015-09-01 17:47 | 12M | |
| AGN-Lectures-2.pdf | 2015-09-01 17:47 | 13M | |
| A620_stellar_pops_lec5.pdf | 2013-09-18 12:56 | 11M | |
| A620_stellar_pops_2017_lec3.pdf | 2017-09-21 10:01 | 7.7M | |
| A620_stellar_pops_2017_lec2.pdf | 2017-09-14 09:38 | 28M | |
| A620_stellar_pops_2017_lec1.pdf | 2017-09-12 13:34 | 21M | |
| A620_star formation.pdf | 2013-11-08 17:05 | 7.1M | |
| A620_star_formation_2017_lec3.pdf | 2017-11-15 15:35 | 467K | |
| A620_star_formation_2017_lec2.pdf | 2017-11-13 15:54 | 8.3M | |
| A620_star_formation_2017_lec1.pdf | 2017-11-09 11:33 | 1.1M | |
| A620_introduction_lec3.pdf | 2017-09-07 09:41 | 25M | |
| A620_introduction_lec2.pdf | 2017-08-30 16:40 | 26M | |
| A620_introduction_lec1.pdf | 2017-08-28 16:07 | 8.1M | |
| A620_intro_2015_lec2.pdf | 2015-09-03 16:41 | 17M | |
| A620_intro_2015_lec1.pdf | 2015-09-01 20:32 | 9.2M | |
| A620_gas_lec1_2017.pdf | 2017-09-25 17:25 | 21M | |
| A620_dust_2017_lec2.pdf | 2017-10-05 14:04 | 3.7M | |
| A620_dust_2017_lec1.pdf | 2017-10-02 22:16 | 11M | |
| A620_Summary_2017.pdf | 2017-12-13 08:55 | 17M | |
| A620_Summary_2015.pdf | 2015-12-10 16:44 | 17M | |
| A620_Stars_2017_lec3.pdf | 2017-09-18 16:26 | 4.0M | |
| A620_Star_formation_2015_lec1_2.pdf | 2015-11-03 16:17 | 3.9M | |
| A620_Spirals_Lectures.pdf | 2013-11-19 15:43 | 28M | |
| A620_MilkyWay_lec3.pdf | 2017-10-16 17:31 | 4.7M | |
| A620_MilkyWay_lec1_2.pdf | 2015-10-06 18:04 | 27M | |
| A620_MW_lec1_2017.pdf | 2017-10-10 06:35 | 20M | |
| A620_MW_2017_lec2.pdf | 2017-10-11 15:51 | 5.7M | |
| A620_Local group.pdf | 2013-11-02 11:27 | 21M | |
| A620_Local_Group_2017_lec3.pdf | 2017-11-09 11:33 | 1.6M | |
| A620_Local Group_lec1.pdf | 2017-11-06 16:56 | 3.5M | |
| A620_Local Group_2017_lec2.pdf | 2017-11-06 17:04 | 4.6M | |
| A620_Galaxies_intro_lec3.pdf | 2013-09-11 13:01 | 12M | |
| A620_Galaxies_intro_lec2.pdf | 2013-09-07 11:35 | 28M | |
| A620_Galaxies_intro_lec1.pdf | 2013-09-05 09:59 | 28M | |
| A620_Elliptical_Galaxies_2017_lec2.pdf | 2017-11-30 09:40 | 11M | |
| A620_Elliptical_Galaxies_2017_lec1.pdf | 2017-11-27 16:48 | 11M | |
| A620_Elliptical_Galaxies_2015_lec3.pdf | 2015-11-24 15:55 | 9.7M | |
| A620_Elliptical_Galaxies_2015_Lec_1_2.pdf | 2015-11-19 15:41 | 11M | |
| A620_Dynamics_lec1.pdf | 2017-10-23 17:29 | 790K | |
| A620_Dynamics_2017_lec3.pdf | 2017-10-31 11:40 | 394K | |
| A620_Dynamics_2017_lec2.pdf | 2017-10-26 09:50 | 853K | |
| A620_Dynamics_2017_lec1.pdf | 2017-10-24 17:21 | 791K | |
| A620_Dynamics_1.pdf | 2013-10-16 08:44 | 3.4M | |
| A620_Dust.pdf | 2013-10-05 13:38 | 8.2M | |
| A620_Chemical_Evolution.pdf | 2013-11-08 17:01 | 5.7M | |
| A620_AGN_lec3_2015.pdf | 2015-12-09 14:27 | 19M | |
| A620_AGN_lec1_2015.pdf | 2015-12-02 13:46 | 5.3M | |
| A620_AGN_3_2017.pdf | 2017-12-11 16:14 | 5.5M | |
| A620_AGN_2_2017.pdf | 2017-12-07 11:06 | 5.6M | |
| A620_AGN_2_2015.pdf | 2015-12-07 09:15 | 5.7M | |
| A620_AGN_2_3.pdf | 2013-12-14 09:15 | 35M | |
| A620_AGN_1_2017.pdf | 2017-12-05 11:35 | 5.6M | |
| A620_AGN_1.pdf | 2013-12-07 13:46 | 18M | |
| A620_2017_Spirals_Lectures_lec2.pdf | 2017-11-21 11:28 | 4.5M | |
| A620_2017_Spirals_Lectures_lec1.pdf | 2017-11-15 15:35 | 4.7M | |
| A620_2015_stellar_pops_lec2.pdf | 2015-09-22 16:29 | 4.0M | |
| A620_2015_stellar_pops_lec1.pdf | 2015-09-19 08:02 | 9.7M | |
| A620_2015_dust.pdf | 2015-10-01 15:45 | 11M | |
| A620_2015_Spirals_lectures.pdf | 2015-11-12 16:05 | 14M | |
| A620_2015_Local group_lec2.pdf | 2015-10-30 13:40 | 9.5M | |
| A620_2015_Local group_lec1.pdf | 2015-10-28 09:50 | 5.8M | |
| A620_2015_Gas_lec2.pdf | 2015-09-29 19:35 | 21M | |
| A620_2015_Gas_lec1.pdf | 2015-09-25 11:34 | 4.9M | |
| A620_2015_Dynamics_2_3.pdf | 2015-10-24 12:07 | 1.3M | |
| A620_2015_Dynamics_1.pdf | 2015-10-23 17:09 | 777K | |
| A620 2013 project.pdf | 2013-11-19 22:41 | 26K | |
| A421_star formation_Lec17.pdf | 2015-09-01 17:47 | 2.5M | |
| A421_Summary.pdf | 2015-09-01 17:47 | 17M | |
| A421_Spirals_Lectures_short.pdf | 2015-09-01 17:47 | 3.2M | |
| A421_Spirals_Lectures.pdf | 2015-09-01 17:47 | 7.9M | |
| A421_Spirals_Lec16.pdf | 2015-09-01 17:47 | 7.9M | |
| A421_Galaxy form-change-movie_2.pdf | 2015-09-01 17:47 | 10M | |
| A421_Galaxy form-change-movie_1.pdf | 2015-09-01 17:47 | 12M | |
| A421_Galaxies_forming_3a.pdf | 2015-09-01 17:47 | 9.2M | |
| A421_GAS_lec7.pdf | 2015-09-01 17:47 | 9.7M | |
| A421_Elliptical Galaxies_Lec20.pdf | 2015-09-01 17:47 | 1.8M | |
| A421_Elliptical Galaxies_Lec19.pdf | 2015-09-01 17:47 | 2.8M | |
| A421_Elliptical Galaxies_Lec18.pdf | 2015-09-01 17:47 | 4.7M | |
| A421_Dynamics_lec13.pdf | 2015-09-01 17:47 | 336K | |
| A421_Dynamics_lec12.pdf | 2015-09-01 17:47 | 863K | |
| A421_Dynamics_lec11.pdf | 2015-09-01 17:47 | 896K | |
| A421_Dust_lec8.pdf | 2015-09-01 17:47 | 3.8M | |
| A421_Cluster_lec2.pdf | 2015-09-01 17:47 | 14M | |
| A421_Cluster_I.pdf | 2015-09-01 17:47 | 8.4M | |
| A421_AGN_lec2.pdf | 2015-09-01 17:47 | 8.8M | |
| A421_AGN_1.pdf | 2015-09-01 17:47 | 3.0M | |
| 1998IAUS__184__387V.pdf | 2015-09-01 17:47 | 153K | |
| 1994MNRAS_270__271V.pdf | 2015-09-01 17:47 | 731K | |
| 1993MNRAS_265___43H.pdf | 2015-09-01 17:47 | 874K | |
| 1992PASP__104__599J.pdf | 2015-09-01 17:47 | 12M | |
| 1983IAUS__100___69V.pdf | 2015-09-01 17:47 | 622K | |
| 1983ApJ___273__458S.pdf | 2015-09-01 17:47 | 2.3M | |
| 1408.0174v1.pdf | 2015-09-01 17:47 | 1.6M | |
| 1210.3628.pdf | 2015-09-01 17:47 | 2.8M | |
| 1208.1505.pdf | 2015-09-01 17:47 | 252K | |
| 1208.0341.pdf | 2015-09-01 17:47 | 2.5M | |
| 1111.5707v2.pdf | 2015-09-01 17:47 | 1.0M | |
| 3c120_Tombesi.pdf | 2015-09-01 17:47 | 1.9M | |
| 0906.2805v3.pdf | 2015-09-01 17:47 | 545K | |